C48H62FN5O12 — CID 53261100
tritert-butyl 10-[2-[[3'-(2-fluoroethoxy)-6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl]amino]ethyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate (PubChem CID 53261100) has the molecular formula C48H62FN5O12 and a molecular weight of 920.04 g/mol. Its IUPAC name is tritert-butyl 10-[2-[[3'-(2-fluoroethoxy)-6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl]amino]ethyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate.
| Compound Name | tritert-butyl 10-[2-[[3'-(2-fluoroethoxy)-6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl]amino]ethyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate |
|---|---|
| PubChem CID | 53261100 |
| Molecular Formula | C48H62FN5O12 |
| Molecular Weight | 920.04 g/mol |
| Exact Mass | 919.44 |
| IUPAC Name | tritert-butyl 10-[2-[[3'-(2-fluoroethoxy)-6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl]amino]ethyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCNC(=O)c2ccc3c(c2)C(=O)OC32c3ccc(O)cc3Oc3cc(OCCF)ccc32)CCN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C48H62FN5O12/c1-45(2,3)64-42(58)52-21-19-51(20-22-53(43(59)65-46(4,5)6)24-26-54(25-23-52)44(60)66-47(7,8)9)18-17-50-40(56)31-10-13-35-34(28-31)41(57)63-48(35)36-14-11-32(55)29-38(36)62-39-30-33(61-27-16-49)12-15-37(39)48/h10-15,28-30,55H,16-27H2,1-9H3,(H,50,56) |
| InChIKey | MWXLBBPNSHSLNV-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 185.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 920.04 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|