About methyl 5-ethenyl-3,6-dihydro-2H-pyridine-1-carboxylate
methyl 5-ethenyl-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 53261133) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is methyl 5-ethenyl-3,6-dihydro-2H-pyridine-1-carboxylate.
Molecular Properties
| Compound Name | methyl 5-ethenyl-3,6-dihydro-2H-pyridine-1-carboxylate |
| PubChem CID | 53261133 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | methyl 5-ethenyl-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C=CC1=CCCN(C(=O)OC)C1 |
| InChI | InChI=1S/C9H13NO2/c1-3-8-5-4-6-10(7-8)9(11)12-2/h3,5H,1,4,6-7H2,2H3 |
| InChIKey | UQXAFIIHFPLRTI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 5-ethenyl-3,6-dihydro-2H-pyridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-ethenyl-3,6-dihydro-2H-pyridine-1-carboxylate?
The IUPAC name of methyl 5-ethenyl-3,6-dihydro-2H-pyridine-1-carboxylate (CID 53261133) is methyl 5-ethenyl-3,6-dihydro-2H-pyridine-1-carboxylate.
What is the SMILES notation for methyl 5-ethenyl-3,6-dihydro-2H-pyridine-1-carboxylate?
The canonical SMILES for methyl 5-ethenyl-3,6-dihydro-2H-pyridine-1-carboxylate is C=CC1=CCCN(C(=O)OC)C1.
What is the InChIKey of methyl 5-ethenyl-3,6-dihydro-2H-pyridine-1-carboxylate?
The InChIKey is UQXAFIIHFPLRTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2/c1-3-8-5-4-6-10(7-8)9(11)12-2/h3,5H,1,4,6-7H2,2H3.
What are the key properties of methyl 5-ethenyl-3,6-dihydro-2H-pyridine-1-carboxylate?
methyl 5-ethenyl-3,6-dihydro-2H-pyridine-1-carboxylate has a molecular weight of 167.21 g/mol, XLogP of 1.57, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-ethenyl-3,6-dihydro-2H-pyridine-1-carboxylate is sourced from PubChem (CID 53261133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).