C29H37ClINO3 — CID 53261270
(9-chloro-4-methyl-13-oxa-4-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-yl)methyl 4-tert-butylcyclohexane-1-carboxylate iodide (PubChem CID 53261270) has the molecular formula C29H37ClINO3 and a molecular weight of 609.98 g/mol. Its IUPAC name is (9-chloro-4-methyl-13-oxa-4-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-yl)methyl 4-tert-butylcyclohexane-1-carboxylate iodide.
| Compound Name | (9-chloro-4-methyl-13-oxa-4-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-yl)methyl 4-tert-butylcyclohexane-1-carboxylate iodide |
|---|---|
| PubChem CID | 53261270 |
| Molecular Formula | C29H37ClINO3 |
| Molecular Weight | 609.98 g/mol |
| Exact Mass | 609.15 |
| IUPAC Name | (9-chloro-4-methyl-13-oxa-4-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-yl)methyl 4-tert-butylcyclohexane-1-carboxylate iodide |
| SMILES | CC(C)(C)C1CCC(C(=O)OC[N+]2(C)CC3c4ccccc4Oc4ccc(Cl)cc4C3C2)CC1.[I-] |
| InChI | InChI=1S/C29H37ClNO3.HI/c1-29(2,3)20-11-9-19(10-12-20)28(32)33-18-31(4)16-24-22-7-5-6-8-26(22)34-27-14-13-21(30)15-23(27)25(24)17-31;/h5-8,13-15,19-20,24-25H,9-12,16-18H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | YFJPETZHWWAGOR-UHFFFAOYSA-M |
| XLogP | 4.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.98 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|