C24H29ClNO4+ — CID 53261279
(9-chloro-4-methyl-13-oxa-4-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-yl)methyl pentan-3-yl carbonate (PubChem CID 53261279) has the molecular formula C24H29ClNO4+ and a molecular weight of 430.95 g/mol. Its IUPAC name is (9-chloro-4-methyl-13-oxa-4-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-yl)methyl pentan-3-yl carbonate.
| Compound Name | (9-chloro-4-methyl-13-oxa-4-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-yl)methyl pentan-3-yl carbonate |
|---|---|
| PubChem CID | 53261279 |
| Molecular Formula | C24H29ClNO4+ |
| Molecular Weight | 430.95 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | (9-chloro-4-methyl-13-oxa-4-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-yl)methyl pentan-3-yl carbonate |
| SMILES | CCC(CC)OC(=O)OC[N+]1(C)CC2c3ccccc3Oc3ccc(Cl)cc3C2C1 |
| InChI | InChI=1S/C24H29ClNO4/c1-4-17(5-2)29-24(27)28-15-26(3)13-20-18-8-6-7-9-22(18)30-23-11-10-16(25)12-19(23)21(20)14-26/h6-12,17,20-21H,4-5,13-15H2,1-3H3/q+1 |
| InChIKey | CZDLAIVXIJUBDA-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.95 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|