About (Z)-4-methylpent-2-ene
(Z)-4-methylpent-2-ene (PubChem CID 5326159) has the molecular formula C6H12
and a molecular weight of 84.16 g/mol. Its IUPAC name is (Z)-4-methylpent-2-ene.
Molecular Properties
| Compound Name | (Z)-4-methylpent-2-ene |
| PubChem CID | 5326159 |
| Molecular Formula | C6H12 |
| Molecular Weight | 84.16 g/mol |
| Exact Mass | 84.09 |
| IUPAC Name | (Z)-4-methylpent-2-ene |
| SMILES | C/C=C\C(C)C |
| InChI | InChI=1S/C6H12/c1-4-5-6(2)3/h4-6H,1-3H3/b5-4- |
| InChIKey | LGAQJENWWYGFSN-PLNGDYQASA-N |
| XLogP | 2.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 84.16 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-methylpent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-methylpent-2-ene?
The IUPAC name of (Z)-4-methylpent-2-ene (CID 5326159) is (Z)-4-methylpent-2-ene.
What is the SMILES notation for (Z)-4-methylpent-2-ene?
The canonical SMILES for (Z)-4-methylpent-2-ene is C/C=C\C(C)C.
What is the InChIKey of (Z)-4-methylpent-2-ene?
The InChIKey is LGAQJENWWYGFSN-PLNGDYQASA-N. The full InChI is InChI=1S/C6H12/c1-4-5-6(2)3/h4-6H,1-3H3/b5-4-.
What are the key properties of (Z)-4-methylpent-2-ene?
(Z)-4-methylpent-2-ene has a molecular weight of 84.16 g/mol, XLogP of 2.22, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-methylpent-2-ene is sourced from PubChem (CID 5326159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).