About 3-(imidazo[1,2-a]pyridin-6-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine
3-(imidazo[1,2-a]pyridin-6-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine (PubChem CID 53261691) has the molecular formula C16H13N9
and a molecular weight of 331.34 g/mol. Its IUPAC name is 3-(imidazo[1,2-a]pyridin-6-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine.
Molecular Properties
| Compound Name | 3-(imidazo[1,2-a]pyridin-6-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine |
| PubChem CID | 53261691 |
| Molecular Formula | C16H13N9 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 3-(imidazo[1,2-a]pyridin-6-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine |
| SMILES | Cn1cc(-c2cnc3nnn(Cc4ccc5nccn5c4)c3n2)cn1 |
| InChI | InChI=1S/C16H13N9/c1-23-10-12(6-19-23)13-7-18-15-16(20-13)25(22-21-15)9-11-2-3-14-17-4-5-24(14)8-11/h2-8,10H,9H2,1H3 |
| InChIKey | HWQZQGUNPZBXNP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 91.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 3-(imidazo[1,2-a]pyridin-6-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(imidazo[1,2-a]pyridin-6-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine?
The IUPAC name of 3-(imidazo[1,2-a]pyridin-6-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine (CID 53261691) is 3-(imidazo[1,2-a]pyridin-6-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine.
What is the SMILES notation for 3-(imidazo[1,2-a]pyridin-6-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine?
The canonical SMILES for 3-(imidazo[1,2-a]pyridin-6-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine is Cn1cc(-c2cnc3nnn(Cc4ccc5nccn5c4)c3n2)cn1.
What is the InChIKey of 3-(imidazo[1,2-a]pyridin-6-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine?
The InChIKey is HWQZQGUNPZBXNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N9/c1-23-10-12(6-19-23)13-7-18-15-16(20-13)25(22-21-15)9-11-2-3-14-17-4-5-24(14)8-11/h2-8,10H,9H2,1H3.
What are the key properties of 3-(imidazo[1,2-a]pyridin-6-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine?
3-(imidazo[1,2-a]pyridin-6-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine has a molecular weight of 331.34 g/mol, XLogP of 1.32, 3 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(imidazo[1,2-a]pyridin-6-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine is sourced from PubChem (CID 53261691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).