C16H11F3N10 — CID 53261807
3-([1,2,4]triazolo[1,5-a]pyridin-6-ylmethyl)-5-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]triazolo[4,5-b]pyrazine (PubChem CID 53261807) has the molecular formula C16H11F3N10 and a molecular weight of 400.33 g/mol. Its IUPAC name is 3-([1,2,4]triazolo[1,5-a]pyridin-6-ylmethyl)-5-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]triazolo[4,5-b]pyrazine.
| Compound Name | 3-([1,2,4]triazolo[1,5-a]pyridin-6-ylmethyl)-5-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]triazolo[4,5-b]pyrazine |
|---|---|
| PubChem CID | 53261807 |
| Molecular Formula | C16H11F3N10 |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 3-([1,2,4]triazolo[1,5-a]pyridin-6-ylmethyl)-5-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]triazolo[4,5-b]pyrazine |
| SMILES | FC(F)(F)Cn1cc(-c2cnc3nnn(Cc4ccc5ncnn5c4)c3n2)cn1 |
| InChI | InChI=1S/C16H11F3N10/c17-16(18,19)8-27-7-11(3-22-27)12-4-20-14-15(24-12)29(26-25-14)6-10-1-2-13-21-9-23-28(13)5-10/h1-5,7,9H,6,8H2 |
| InChIKey | AQCJZJRWKLOTCI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 104.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |