C16H11N3O3S — CID 53261837
(5E)-5-[[5-(1-oxo-2,3-dihydroisoindol-5-yl)thiophen-2-yl]methylidene]imidazolidine-2,4-dione (PubChem CID 53261837) has the molecular formula C16H11N3O3S and a molecular weight of 325.35 g/mol. Its IUPAC name is (5E)-5-[[5-(1-oxo-2,3-dihydroisoindol-5-yl)thiophen-2-yl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[5-(1-oxo-2,3-dihydroisoindol-5-yl)thiophen-2-yl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 53261837 |
| Molecular Formula | C16H11N3O3S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | (5E)-5-[[5-(1-oxo-2,3-dihydroisoindol-5-yl)thiophen-2-yl]methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2ccc(-c3ccc4c(c3)CNC4=O)s2)N1 |
| InChI | InChI=1S/C16H11N3O3S/c20-14-11-3-1-8(5-9(11)7-17-14)13-4-2-10(23-13)6-12-15(21)19-16(22)18-12/h1-6H,7H2,(H,17,20)(H2,18,19,21,22)/b12-6+ |
| InChIKey | FUYOHNLRYMIVCL-WUXMJOGZSA-N |
| XLogP | 1.84 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|