C24H43B — CID 5326207
[(2R)-butan-2-yl]-bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane (PubChem CID 5326207) has the molecular formula C24H43B and a molecular weight of 342.42 g/mol. Its IUPAC name is [(2R)-butan-2-yl]-bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane.
| Compound Name | [(2R)-butan-2-yl]-bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane |
|---|---|
| PubChem CID | 5326207 |
| Molecular Formula | C24H43B |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.35 |
| IUPAC Name | [(2R)-butan-2-yl]-bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane |
| SMILES | CC[C@@H](C)B([C@@H]1C[C@@H]2C[C@H]([C@H]1C)C2(C)C)[C@@H]1C[C@@H]2C[C@H]([C@H]1C)C2(C)C |
| InChI | InChI=1S/C24H43B/c1-9-14(2)25(21-12-17-10-19(15(21)3)23(17,5)6)22-13-18-11-20(16(22)4)24(18,7)8/h14-22H,9-13H2,1-8H3/t14-,15-,16-,17+,18+,19-,20-,21-,22-/m1/s1 |
| InChIKey | GXFGVLUUGTUXDB-BLZMNUIKSA-N |
| XLogP | 7.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|