About Monodehydroascorbate anion
Monodehydroascorbate anion (PubChem CID 53262277) has the molecular formula C6H6O6-
and a molecular weight of 174.11 g/mol.
Molecular Properties
| Compound Name | Monodehydroascorbate anion |
| PubChem CID | 53262277 |
| Molecular Formula | C6H6O6- |
| Molecular Weight | 174.11 g/mol |
| Exact Mass | 174.02 |
| IUPAC Name | — |
| SMILES | [O]C1=C([O-])[C@@H]([C@@H](O)CO)OC1=O |
| InChI | InChI=1S/C6H7O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-9H,1H2/p-1/t2-,5+/m0/s1 |
| InChIKey | ABKUDKDWDKRLNF-JLAZNSOCSA-M |
| XLogP | -2.73 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.11 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze Monodehydroascorbate anion with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Monodehydroascorbate anion?
The IUPAC name of Monodehydroascorbate anion (CID 53262277) is not available.
What is the SMILES notation for Monodehydroascorbate anion?
The canonical SMILES for Monodehydroascorbate anion is [O]C1=C([O-])[C@@H]([C@@H](O)CO)OC1=O.
What is the InChIKey of Monodehydroascorbate anion?
The InChIKey is ABKUDKDWDKRLNF-JLAZNSOCSA-M. The full InChI is InChI=1S/C6H7O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-9H,1H2/p-1/t2-,5+/m0/s1.
What are the key properties of Monodehydroascorbate anion?
Monodehydroascorbate anion has a molecular weight of 174.11 g/mol, XLogP of -2.73, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Monodehydroascorbate anion is sourced from PubChem (CID 53262277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).