About 2,5-bis(4-hydroxyphenyl)-4-methoxybenzene-1,3-diol
2,5-bis(4-hydroxyphenyl)-4-methoxybenzene-1,3-diol (PubChem CID 53262748) has the molecular formula C19H16O5
and a molecular weight of 324.33 g/mol. Its IUPAC name is 2,5-bis(4-hydroxyphenyl)-4-methoxybenzene-1,3-diol.
Molecular Properties
| Compound Name | 2,5-bis(4-hydroxyphenyl)-4-methoxybenzene-1,3-diol |
| PubChem CID | 53262748 |
| Molecular Formula | C19H16O5 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 2,5-bis(4-hydroxyphenyl)-4-methoxybenzene-1,3-diol |
| SMILES | COc1c(-c2ccc(O)cc2)cc(O)c(-c2ccc(O)cc2)c1O |
| InChI | InChI=1S/C19H16O5/c1-24-19-15(11-2-6-13(20)7-3-11)10-16(22)17(18(19)23)12-4-8-14(21)9-5-12/h2-10,20-23H,1H3 |
| InChIKey | ZMEOGHAIJYBVMI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,5-bis(4-hydroxyphenyl)-4-methoxybenzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(4-hydroxyphenyl)-4-methoxybenzene-1,3-diol?
The IUPAC name of 2,5-bis(4-hydroxyphenyl)-4-methoxybenzene-1,3-diol (CID 53262748) is 2,5-bis(4-hydroxyphenyl)-4-methoxybenzene-1,3-diol.
What is the SMILES notation for 2,5-bis(4-hydroxyphenyl)-4-methoxybenzene-1,3-diol?
The canonical SMILES for 2,5-bis(4-hydroxyphenyl)-4-methoxybenzene-1,3-diol is COc1c(-c2ccc(O)cc2)cc(O)c(-c2ccc(O)cc2)c1O.
What is the InChIKey of 2,5-bis(4-hydroxyphenyl)-4-methoxybenzene-1,3-diol?
The InChIKey is ZMEOGHAIJYBVMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16O5/c1-24-19-15(11-2-6-13(20)7-3-11)10-16(22)17(18(19)23)12-4-8-14(21)9-5-12/h2-10,20-23H,1H3.
What are the key properties of 2,5-bis(4-hydroxyphenyl)-4-methoxybenzene-1,3-diol?
2,5-bis(4-hydroxyphenyl)-4-methoxybenzene-1,3-diol has a molecular weight of 324.33 g/mol, XLogP of 3.85, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(4-hydroxyphenyl)-4-methoxybenzene-1,3-diol is sourced from PubChem (CID 53262748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).