C20H30O5 — CID 53262794
(2E,6E)-8-[(2E,6E)-8-hydroxy-2,6-dimethylocta-2,6-dienoyl]oxy-2,6-dimethylocta-2,6-dienoic acid (PubChem CID 53262794) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (2E,6E)-8-[(2E,6E)-8-hydroxy-2,6-dimethylocta-2,6-dienoyl]oxy-2,6-dimethylocta-2,6-dienoic acid.
| Compound Name | (2E,6E)-8-[(2E,6E)-8-hydroxy-2,6-dimethylocta-2,6-dienoyl]oxy-2,6-dimethylocta-2,6-dienoic acid |
|---|---|
| PubChem CID | 53262794 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (2E,6E)-8-[(2E,6E)-8-hydroxy-2,6-dimethylocta-2,6-dienoyl]oxy-2,6-dimethylocta-2,6-dienoic acid |
| SMILES | C/C(=C\CO)CC/C=C(\C)C(=O)OC/C=C(\C)CC/C=C(\C)C(=O)O |
| InChI | InChI=1S/C20H30O5/c1-15(11-13-21)7-6-10-18(4)20(24)25-14-12-16(2)8-5-9-17(3)19(22)23/h9-12,21H,5-8,13-14H2,1-4H3,(H,22,23)/b15-11+,16-12+,17-9+,18-10+ |
| InChIKey | QOEZNNVCUUKXPK-KXXJHGMOSA-N |
| XLogP | 3.95 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|