C30H44N4O6 — CID 53262864
(3S,6S,9R,12S,16S)-6-[(2S)-butan-2-yl]-9-methyl-16-[(E)-2-phenylethenyl]-3,12-di(propan-2-yl)-1-oxa-4,7,10,13-tetrazacyclohexadecane-2,5,8,11,14-pentone (PubChem CID 53262864) has the molecular formula C30H44N4O6 and a molecular weight of 556.70 g/mol. Its IUPAC name is (3S,6S,9R,12S,16S)-6-[(2S)-butan-2-yl]-9-methyl-16-[(E)-2-phenylethenyl]-3,12-di(propan-2-yl)-1-oxa-4,7,10,13-tetrazacyclohexadecane-2,5,8,11,14-pentone.
| Compound Name | (3S,6S,9R,12S,16S)-6-[(2S)-butan-2-yl]-9-methyl-16-[(E)-2-phenylethenyl]-3,12-di(propan-2-yl)-1-oxa-4,7,10,13-tetrazacyclohexadecane-2,5,8,11,14-pentone |
|---|---|
| PubChem CID | 53262864 |
| Molecular Formula | C30H44N4O6 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.33 |
| IUPAC Name | (3S,6S,9R,12S,16S)-6-[(2S)-butan-2-yl]-9-methyl-16-[(E)-2-phenylethenyl]-3,12-di(propan-2-yl)-1-oxa-4,7,10,13-tetrazacyclohexadecane-2,5,8,11,14-pentone |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@@H](C)NC(=O)[C@H](C(C)C)NC(=O)C[C@@H](/C=C/c2ccccc2)OC(=O)[C@H](C(C)C)NC1=O |
| InChI | InChI=1S/C30H44N4O6/c1-8-19(6)26-29(38)33-25(18(4)5)30(39)40-22(15-14-21-12-10-9-11-13-21)16-23(35)32-24(17(2)3)28(37)31-20(7)27(36)34-26/h9-15,17-20,22,24-26H,8,16H2,1-7H3,(H,31,37)(H,32,35)(H,33,38)(H,34,36)/b15-14+/t19-,20+,22+,24-,25-,26-/m0/s1 |
| InChIKey | SMWGFJCKWZCJNQ-QWGWBJRGSA-N |
| XLogP | 2.33 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |