About (4S)-5,5-dimethyl-4-(3-oxobutyl)oxolan-2-one
(4S)-5,5-dimethyl-4-(3-oxobutyl)oxolan-2-one (PubChem CID 5326287) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is (4S)-5,5-dimethyl-4-(3-oxobutyl)oxolan-2-one.
Molecular Properties
| Compound Name | (4S)-5,5-dimethyl-4-(3-oxobutyl)oxolan-2-one |
| PubChem CID | 5326287 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (4S)-5,5-dimethyl-4-(3-oxobutyl)oxolan-2-one |
| SMILES | CC(=O)CC[C@H]1CC(=O)OC1(C)C |
| InChI | InChI=1S/C10H16O3/c1-7(11)4-5-8-6-9(12)13-10(8,2)3/h8H,4-6H2,1-3H3/t8-/m0/s1 |
| InChIKey | AWQSAIIDOMEEOD-QMMMGPOBSA-N |
| XLogP | 1.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-5,5-dimethyl-4-(3-oxobutyl)oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-5,5-dimethyl-4-(3-oxobutyl)oxolan-2-one?
The IUPAC name of (4S)-5,5-dimethyl-4-(3-oxobutyl)oxolan-2-one (CID 5326287) is (4S)-5,5-dimethyl-4-(3-oxobutyl)oxolan-2-one.
What is the SMILES notation for (4S)-5,5-dimethyl-4-(3-oxobutyl)oxolan-2-one?
The canonical SMILES for (4S)-5,5-dimethyl-4-(3-oxobutyl)oxolan-2-one is CC(=O)CC[C@H]1CC(=O)OC1(C)C.
What is the InChIKey of (4S)-5,5-dimethyl-4-(3-oxobutyl)oxolan-2-one?
The InChIKey is AWQSAIIDOMEEOD-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H16O3/c1-7(11)4-5-8-6-9(12)13-10(8,2)3/h8H,4-6H2,1-3H3/t8-/m0/s1.
What are the key properties of (4S)-5,5-dimethyl-4-(3-oxobutyl)oxolan-2-one?
(4S)-5,5-dimethyl-4-(3-oxobutyl)oxolan-2-one has a molecular weight of 184.23 g/mol, XLogP of 1.70, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-5,5-dimethyl-4-(3-oxobutyl)oxolan-2-one is sourced from PubChem (CID 5326287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).