About 5,6-dibromo-4-nitro-2,1,3-benzothiadiazole
5,6-dibromo-4-nitro-2,1,3-benzothiadiazole (PubChem CID 53263204) has the molecular formula C6HBr2N3O2S
and a molecular weight of 338.97 g/mol. Its IUPAC name is 5,6-dibromo-4-nitro-2,1,3-benzothiadiazole.
Molecular Properties
| Compound Name | 5,6-dibromo-4-nitro-2,1,3-benzothiadiazole |
| PubChem CID | 53263204 |
| Molecular Formula | C6HBr2N3O2S |
| Molecular Weight | 338.97 g/mol |
| Exact Mass | 336.82 |
| IUPAC Name | 5,6-dibromo-4-nitro-2,1,3-benzothiadiazole |
| SMILES | O=[N+]([O-])c1c(Br)c(Br)cc2nsnc12 |
| InChI | InChI=1S/C6HBr2N3O2S/c7-2-1-3-5(10-14-9-3)6(4(2)8)11(12)13/h1H |
| InChIKey | QNWLEZNYOIMYEP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.97 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dibromo-4-nitro-2,1,3-benzothiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dibromo-4-nitro-2,1,3-benzothiadiazole?
The IUPAC name of 5,6-dibromo-4-nitro-2,1,3-benzothiadiazole (CID 53263204) is 5,6-dibromo-4-nitro-2,1,3-benzothiadiazole.
What is the SMILES notation for 5,6-dibromo-4-nitro-2,1,3-benzothiadiazole?
The canonical SMILES for 5,6-dibromo-4-nitro-2,1,3-benzothiadiazole is O=[N+]([O-])c1c(Br)c(Br)cc2nsnc12.
What is the InChIKey of 5,6-dibromo-4-nitro-2,1,3-benzothiadiazole?
The InChIKey is QNWLEZNYOIMYEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6HBr2N3O2S/c7-2-1-3-5(10-14-9-3)6(4(2)8)11(12)13/h1H.
What are the key properties of 5,6-dibromo-4-nitro-2,1,3-benzothiadiazole?
5,6-dibromo-4-nitro-2,1,3-benzothiadiazole has a molecular weight of 338.97 g/mol, XLogP of 3.12, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dibromo-4-nitro-2,1,3-benzothiadiazole is sourced from PubChem (CID 53263204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).