About 4-chloro-5-methyl-2,1,3-benzothiadiazol-7-amine
4-chloro-5-methyl-2,1,3-benzothiadiazol-7-amine (PubChem CID 53263208) has the molecular formula C7H6ClN3S
and a molecular weight of 199.67 g/mol. Its IUPAC name is 4-chloro-5-methyl-2,1,3-benzothiadiazol-7-amine.
Molecular Properties
| Compound Name | 4-chloro-5-methyl-2,1,3-benzothiadiazol-7-amine |
| PubChem CID | 53263208 |
| Molecular Formula | C7H6ClN3S |
| Molecular Weight | 199.67 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | 4-chloro-5-methyl-2,1,3-benzothiadiazol-7-amine |
| SMILES | Cc1cc(N)c2nsnc2c1Cl |
| InChI | InChI=1S/C7H6ClN3S/c1-3-2-4(9)6-7(5(3)8)11-12-10-6/h2H,9H2,1H3 |
| InChIKey | RHICNMPUNYHPHZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.67 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-5-methyl-2,1,3-benzothiadiazol-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-methyl-2,1,3-benzothiadiazol-7-amine?
The IUPAC name of 4-chloro-5-methyl-2,1,3-benzothiadiazol-7-amine (CID 53263208) is 4-chloro-5-methyl-2,1,3-benzothiadiazol-7-amine.
What is the SMILES notation for 4-chloro-5-methyl-2,1,3-benzothiadiazol-7-amine?
The canonical SMILES for 4-chloro-5-methyl-2,1,3-benzothiadiazol-7-amine is Cc1cc(N)c2nsnc2c1Cl.
What is the InChIKey of 4-chloro-5-methyl-2,1,3-benzothiadiazol-7-amine?
The InChIKey is RHICNMPUNYHPHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN3S/c1-3-2-4(9)6-7(5(3)8)11-12-10-6/h2H,9H2,1H3.
What are the key properties of 4-chloro-5-methyl-2,1,3-benzothiadiazol-7-amine?
4-chloro-5-methyl-2,1,3-benzothiadiazol-7-amine has a molecular weight of 199.67 g/mol, XLogP of 2.24, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-methyl-2,1,3-benzothiadiazol-7-amine is sourced from PubChem (CID 53263208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).