C30H40O4 — CID 5326349
[(7R,10E)-2,6,6,10-tetramethyl-13-(7-methyl-5,8-dioxonaphthalen-2-yl)trideca-2,10-dien-7-yl] acetate (PubChem CID 5326349) has the molecular formula C30H40O4 and a molecular weight of 464.65 g/mol. Its IUPAC name is [(7R,10E)-2,6,6,10-tetramethyl-13-(7-methyl-5,8-dioxonaphthalen-2-yl)trideca-2,10-dien-7-yl] acetate.
| Compound Name | [(7R,10E)-2,6,6,10-tetramethyl-13-(7-methyl-5,8-dioxonaphthalen-2-yl)trideca-2,10-dien-7-yl] acetate |
|---|---|
| PubChem CID | 5326349 |
| Molecular Formula | C30H40O4 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | [(7R,10E)-2,6,6,10-tetramethyl-13-(7-methyl-5,8-dioxonaphthalen-2-yl)trideca-2,10-dien-7-yl] acetate |
| SMILES | CC(=O)O[C@H](CC/C(C)=C/CCc1ccc2c(c1)C(=O)C(C)=CC2=O)C(C)(C)CCC=C(C)C |
| InChI | InChI=1S/C30H40O4/c1-20(2)10-9-17-30(6,7)28(34-23(5)31)16-13-21(3)11-8-12-24-14-15-25-26(19-24)29(33)22(4)18-27(25)32/h10-11,14-15,18-19,28H,8-9,12-13,16-17H2,1-7H3/b21-11+/t28-/m1/s1 |
| InChIKey | VOTOIZWGMZJUQH-JONZVSSYSA-N |
| XLogP | 7.38 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|