C12H11N3O6S — CID 53263629
2-[[5-[(3-methyl-4-nitrophenoxy)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid (PubChem CID 53263629) has the molecular formula C12H11N3O6S and a molecular weight of 325.30 g/mol. Its IUPAC name is 2-[[5-[(3-methyl-4-nitrophenoxy)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-[(3-methyl-4-nitrophenoxy)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 53263629 |
| Molecular Formula | C12H11N3O6S |
| Molecular Weight | 325.30 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 2-[[5-[(3-methyl-4-nitrophenoxy)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid |
| SMILES | Cc1cc(OCc2nnc(SCC(=O)O)o2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11N3O6S/c1-7-4-8(2-3-9(7)15(18)19)20-5-10-13-14-12(21-10)22-6-11(16)17/h2-4H,5-6H2,1H3,(H,16,17) |
| InChIKey | OJPWFEKKHRIGAK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|