C14H22O4 — CID 5326388
1-[(1aS,2S,4S,4aS,5R,6R,8aR)-2,6-dihydroxy-4,4a-dimethyl-1a,2,3,4,5,6,7,8-octahydronaphtho[4a,5-b]oxiren-5-yl]ethanone (PubChem CID 5326388) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-[(1aS,2S,4S,4aS,5R,6R,8aR)-2,6-dihydroxy-4,4a-dimethyl-1a,2,3,4,5,6,7,8-octahydronaphtho[4a,5-b]oxiren-5-yl]ethanone.
| Compound Name | 1-[(1aS,2S,4S,4aS,5R,6R,8aR)-2,6-dihydroxy-4,4a-dimethyl-1a,2,3,4,5,6,7,8-octahydronaphtho[4a,5-b]oxiren-5-yl]ethanone |
|---|---|
| PubChem CID | 5326388 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 1-[(1aS,2S,4S,4aS,5R,6R,8aR)-2,6-dihydroxy-4,4a-dimethyl-1a,2,3,4,5,6,7,8-octahydronaphtho[4a,5-b]oxiren-5-yl]ethanone |
| SMILES | CC(=O)[C@H]1[C@H](O)CC[C@]23O[C@H]2[C@@H](O)C[C@H](C)[C@@]13C |
| InChI | InChI=1S/C14H22O4/c1-7-6-10(17)12-14(18-12)5-4-9(16)11(8(2)15)13(7,14)3/h7,9-12,16-17H,4-6H2,1-3H3/t7-,9+,10-,11-,12-,13-,14-/m0/s1 |
| InChIKey | QBZBEMFNBTTWIR-GZWIXIEXSA-N |
| XLogP | 0.89 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|