C17H22O4 — CID 5326391
[(1S,8S,9Z,10aS)-1,9,10a-trimethyl-3,7-dioxo-2,5,6,8-tetrahydro-1H-benzo[8]annulen-8-yl] acetate (PubChem CID 5326391) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is [(1S,8S,9Z,10aS)-1,9,10a-trimethyl-3,7-dioxo-2,5,6,8-tetrahydro-1H-benzo[8]annulen-8-yl] acetate.
| Compound Name | [(1S,8S,9Z,10aS)-1,9,10a-trimethyl-3,7-dioxo-2,5,6,8-tetrahydro-1H-benzo[8]annulen-8-yl] acetate |
|---|---|
| PubChem CID | 5326391 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | [(1S,8S,9Z,10aS)-1,9,10a-trimethyl-3,7-dioxo-2,5,6,8-tetrahydro-1H-benzo[8]annulen-8-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(=O)CCC2=CC(=O)C[C@H](C)[C@@]2(C)/C=C\1C |
| InChI | InChI=1S/C17H22O4/c1-10-9-17(4)11(2)7-14(19)8-13(17)5-6-15(20)16(10)21-12(3)18/h8-9,11,16H,5-7H2,1-4H3/b10-9-/t11-,16-,17+/m0/s1 |
| InChIKey | HAKXFVQZZGAKIY-JMFGWXFPSA-N |
| XLogP | 2.77 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|