C15H22O4 — CID 5326392
[(1R,2S,6S,8S,8aS)-1-acetyl-6-hydroxy-8,8a-dimethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-yl] formate (PubChem CID 5326392) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is [(1R,2S,6S,8S,8aS)-1-acetyl-6-hydroxy-8,8a-dimethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-yl] formate.
| Compound Name | [(1R,2S,6S,8S,8aS)-1-acetyl-6-hydroxy-8,8a-dimethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-yl] formate |
|---|---|
| PubChem CID | 5326392 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | [(1R,2S,6S,8S,8aS)-1-acetyl-6-hydroxy-8,8a-dimethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-yl] formate |
| SMILES | CC(=O)[C@H]1[C@@H](OC=O)CCC2=C[C@@H](O)C[C@H](C)[C@]21C |
| InChI | InChI=1S/C15H22O4/c1-9-6-12(18)7-11-4-5-13(19-8-16)14(10(2)17)15(9,11)3/h7-9,12-14,18H,4-6H2,1-3H3/t9-,12-,13-,14-,15+/m0/s1 |
| InChIKey | SOBSKWVVRYYQRP-XOKYVNOHSA-N |
| XLogP | 1.86 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|