About 5-(3-fluorophenyl)-1H-1,2,4-triazole
5-(3-fluorophenyl)-1H-1,2,4-triazole (PubChem CID 53264352) has the molecular formula C8H6FN3
and a molecular weight of 163.16 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-1H-1,2,4-triazole.
Molecular Properties
| Compound Name | 5-(3-fluorophenyl)-1H-1,2,4-triazole |
| PubChem CID | 53264352 |
| Molecular Formula | C8H6FN3 |
| Molecular Weight | 163.16 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | 5-(3-fluorophenyl)-1H-1,2,4-triazole |
| SMILES | Fc1cccc(-c2ncn[nH]2)c1 |
| InChI | InChI=1S/C8H6FN3/c9-7-3-1-2-6(4-7)8-10-5-11-12-8/h1-5H,(H,10,11,12) |
| InChIKey | RFFDELXTQCRWKB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.16 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(3-fluorophenyl)-1H-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-fluorophenyl)-1H-1,2,4-triazole?
The IUPAC name of 5-(3-fluorophenyl)-1H-1,2,4-triazole (CID 53264352) is 5-(3-fluorophenyl)-1H-1,2,4-triazole.
What is the SMILES notation for 5-(3-fluorophenyl)-1H-1,2,4-triazole?
The canonical SMILES for 5-(3-fluorophenyl)-1H-1,2,4-triazole is Fc1cccc(-c2ncn[nH]2)c1.
What is the InChIKey of 5-(3-fluorophenyl)-1H-1,2,4-triazole?
The InChIKey is RFFDELXTQCRWKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6FN3/c9-7-3-1-2-6(4-7)8-10-5-11-12-8/h1-5H,(H,10,11,12).
What are the key properties of 5-(3-fluorophenyl)-1H-1,2,4-triazole?
5-(3-fluorophenyl)-1H-1,2,4-triazole has a molecular weight of 163.16 g/mol, XLogP of 1.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-fluorophenyl)-1H-1,2,4-triazole is sourced from PubChem (CID 53264352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).