C13H14N2O3S — CID 53265037
ethyl 2-[(5-benzyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate (PubChem CID 53265037) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is ethyl 2-[(5-benzyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate.
| Compound Name | ethyl 2-[(5-benzyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 53265037 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | ethyl 2-[(5-benzyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(Cc2ccccc2)o1 |
| InChI | InChI=1S/C13H14N2O3S/c1-2-17-12(16)9-19-13-15-14-11(18-13)8-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3 |
| InChIKey | SRSXGZIASYETIQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |