C18H20ClNO3 — CID 53265828
N-(2-chloro-4,6-dimethylphenyl)-2-(4-methoxyphenoxy)propanamide (PubChem CID 53265828) has the molecular formula C18H20ClNO3 and a molecular weight of 333.82 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-2-(4-methoxyphenoxy)propanamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-2-(4-methoxyphenoxy)propanamide |
|---|---|
| PubChem CID | 53265828 |
| Molecular Formula | C18H20ClNO3 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-2-(4-methoxyphenoxy)propanamide |
| SMILES | COc1ccc(OC(C)C(=O)Nc2c(C)cc(C)cc2Cl)cc1 |
| InChI | InChI=1S/C18H20ClNO3/c1-11-9-12(2)17(16(19)10-11)20-18(21)13(3)23-15-7-5-14(22-4)6-8-15/h5-10,13H,1-4H3,(H,20,21) |
| InChIKey | SVQHERSGGLVVOQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |