C29H36N2O5S — CID 53266684
N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2-[4-(2-phenylpropan-2-yl)phenoxy]propanamide (PubChem CID 53266684) has the molecular formula C29H36N2O5S and a molecular weight of 524.68 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2-[4-(2-phenylpropan-2-yl)phenoxy]propanamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2-[4-(2-phenylpropan-2-yl)phenoxy]propanamide |
|---|---|
| PubChem CID | 53266684 |
| Molecular Formula | C29H36N2O5S |
| Molecular Weight | 524.68 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2-[4-(2-phenylpropan-2-yl)phenoxy]propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OC)c(NC(=O)C(C)Oc2ccc(C(C)(C)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C29H36N2O5S/c1-7-31(8-2)37(33,34)25-18-19-27(35-6)26(20-25)30-28(32)21(3)36-24-16-14-23(15-17-24)29(4,5)22-12-10-9-11-13-22/h9-21H,7-8H2,1-6H3,(H,30,32) |
| InChIKey | CZSDRELRCFEWAV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.68 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |