C17H14Br2ClNO2 — CID 53267913
(E)-N-(4-bromo-2-chlorophenyl)-3-(5-bromo-2-ethoxyphenyl)prop-2-enamide (PubChem CID 53267913) has the molecular formula C17H14Br2ClNO2 and a molecular weight of 459.57 g/mol. Its IUPAC name is (E)-N-(4-bromo-2-chlorophenyl)-3-(5-bromo-2-ethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(4-bromo-2-chlorophenyl)-3-(5-bromo-2-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 53267913 |
| Molecular Formula | C17H14Br2ClNO2 |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 456.91 |
| IUPAC Name | (E)-N-(4-bromo-2-chlorophenyl)-3-(5-bromo-2-ethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(Br)cc1/C=C/C(=O)Nc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C17H14Br2ClNO2/c1-2-23-16-7-5-12(18)9-11(16)3-8-17(22)21-15-6-4-13(19)10-14(15)20/h3-10H,2H2,1H3,(H,21,22)/b8-3+ |
| InChIKey | XQNNSAIQRAXOCV-FPYGCLRLSA-N |
| XLogP | 5.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|