C17H15BrFNO — CID 53268248
(E)-N-(2-bromo-4-ethylphenyl)-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 53268248) has the molecular formula C17H15BrFNO and a molecular weight of 348.22 g/mol. Its IUPAC name is (E)-N-(2-bromo-4-ethylphenyl)-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(2-bromo-4-ethylphenyl)-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 53268248 |
| Molecular Formula | C17H15BrFNO |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | (E)-N-(2-bromo-4-ethylphenyl)-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | CCc1ccc(NC(=O)/C=C/c2ccc(F)cc2)c(Br)c1 |
| InChI | InChI=1S/C17H15BrFNO/c1-2-12-5-9-16(15(18)11-12)20-17(21)10-6-13-3-7-14(19)8-4-13/h3-11H,2H2,1H3,(H,20,21)/b10-6+ |
| InChIKey | IJSKLFHTWXTPAL-UXBLZVDNSA-N |
| XLogP | 4.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|