C17H19N5O — CID 5326846
9-[(Z)-but-2-enyl]-8-[(3-methoxyphenyl)methyl]purin-6-amine (PubChem CID 5326846) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is 9-[(Z)-but-2-enyl]-8-[(3-methoxyphenyl)methyl]purin-6-amine.
| Compound Name | 9-[(Z)-but-2-enyl]-8-[(3-methoxyphenyl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 5326846 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 9-[(Z)-but-2-enyl]-8-[(3-methoxyphenyl)methyl]purin-6-amine |
| SMILES | C/C=C\Cn1c(Cc2cccc(OC)c2)nc2c(N)ncnc21 |
| InChI | InChI=1S/C17H19N5O/c1-3-4-8-22-14(10-12-6-5-7-13(9-12)23-2)21-15-16(18)19-11-20-17(15)22/h3-7,9,11H,8,10H2,1-2H3,(H2,18,19,20)/b4-3- |
| InChIKey | FMFQHDCXTJQDHQ-ARJAWSKDSA-N |
| XLogP | 2.58 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|