C30H42S — CID 5326992
(1E,3E,7E,14Z)-5-[(E)-but-2-enyl]-3-methyl-6,9,11,12-tetramethylidene-8-(2-methylprop-2-enyl)heptadeca-1,3,7,14-tetraene-1-thiol (PubChem CID 5326992) has the molecular formula C30H42S and a molecular weight of 434.73 g/mol. Its IUPAC name is (1E,3E,7E,14Z)-5-[(E)-but-2-enyl]-3-methyl-6,9,11,12-tetramethylidene-8-(2-methylprop-2-enyl)heptadeca-1,3,7,14-tetraene-1-thiol.
| Compound Name | (1E,3E,7E,14Z)-5-[(E)-but-2-enyl]-3-methyl-6,9,11,12-tetramethylidene-8-(2-methylprop-2-enyl)heptadeca-1,3,7,14-tetraene-1-thiol |
|---|---|
| PubChem CID | 5326992 |
| Molecular Formula | C30H42S |
| Molecular Weight | 434.73 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | (1E,3E,7E,14Z)-5-[(E)-but-2-enyl]-3-methyl-6,9,11,12-tetramethylidene-8-(2-methylprop-2-enyl)heptadeca-1,3,7,14-tetraene-1-thiol |
| SMILES | C=C(C)C/C(=C\C(=C)C(/C=C(C)/C=C/S)C/C=C/C)C(=C)CC(=C)C(=C)C/C=C\CC |
| InChI | InChI=1S/C30H42S/c1-10-12-14-15-25(6)26(7)21-27(8)30(19-23(3)4)22-28(9)29(16-13-11-2)20-24(5)17-18-31/h11-14,17-18,20,22,29,31H,3,6-10,15-16,19,21H2,1-2,4-5H3/b13-11+,14-12-,18-17+,24-20+,30-22+ |
| InChIKey | BQKHZRIQMMOZPS-KANMXYBCSA-N |
| XLogP | 9.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.73 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|