C13H8Cl2N2O3 — CID 53270655
2-[(3,4-dichlorophenyl)carbamoyl]pyridine-3-carboxylic acid (PubChem CID 53270655) has the molecular formula C13H8Cl2N2O3 and a molecular weight of 311.12 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)carbamoyl]pyridine-3-carboxylic acid.
| Compound Name | 2-[(3,4-dichlorophenyl)carbamoyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 53270655 |
| Molecular Formula | C13H8Cl2N2O3 |
| Molecular Weight | 311.12 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)carbamoyl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H8Cl2N2O3/c14-9-4-3-7(6-10(9)15)17-12(18)11-8(13(19)20)2-1-5-16-11/h1-6H,(H,17,18)(H,19,20) |
| InChIKey | LZGMCNIIYRFDAZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.12 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |