C15H10F7NO3 — CID 53270899
2-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]carbamoyl]cyclohexene-1-carboxylic acid (PubChem CID 53270899) has the molecular formula C15H10F7NO3 and a molecular weight of 385.24 g/mol. Its IUPAC name is 2-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]carbamoyl]cyclohexene-1-carboxylic acid.
| Compound Name | 2-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]carbamoyl]cyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 53270899 |
| Molecular Formula | C15H10F7NO3 |
| Molecular Weight | 385.24 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 2-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]carbamoyl]cyclohexene-1-carboxylic acid |
| SMILES | O=C(O)C1=C(C(=O)Nc2c(F)c(F)c(C(F)(F)F)c(F)c2F)CCCC1 |
| InChI | InChI=1S/C15H10F7NO3/c16-8-7(15(20,21)22)9(17)11(19)12(10(8)18)23-13(24)5-3-1-2-4-6(5)14(25)26/h1-4H2,(H,23,24)(H,25,26) |
| InChIKey | AYKNTLNQVCNKDU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.24 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|