About methyl 5-(furan-2-yl)-1,3-thiazole-4-carboxylate
methyl 5-(furan-2-yl)-1,3-thiazole-4-carboxylate (PubChem CID 53271132) has the molecular formula C9H7NO3S
and a molecular weight of 209.23 g/mol. Its IUPAC name is methyl 5-(furan-2-yl)-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(furan-2-yl)-1,3-thiazole-4-carboxylate |
| PubChem CID | 53271132 |
| Molecular Formula | C9H7NO3S |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.01 |
| IUPAC Name | methyl 5-(furan-2-yl)-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1ncsc1-c1ccco1 |
| InChI | InChI=1S/C9H7NO3S/c1-12-9(11)7-8(14-5-10-7)6-3-2-4-13-6/h2-5H,1H3 |
| InChIKey | OPAGXTJFSAGYGK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 5-(furan-2-yl)-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(furan-2-yl)-1,3-thiazole-4-carboxylate?
The IUPAC name of methyl 5-(furan-2-yl)-1,3-thiazole-4-carboxylate (CID 53271132) is methyl 5-(furan-2-yl)-1,3-thiazole-4-carboxylate.
What is the SMILES notation for methyl 5-(furan-2-yl)-1,3-thiazole-4-carboxylate?
The canonical SMILES for methyl 5-(furan-2-yl)-1,3-thiazole-4-carboxylate is COC(=O)c1ncsc1-c1ccco1.
What is the InChIKey of methyl 5-(furan-2-yl)-1,3-thiazole-4-carboxylate?
The InChIKey is OPAGXTJFSAGYGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO3S/c1-12-9(11)7-8(14-5-10-7)6-3-2-4-13-6/h2-5H,1H3.
What are the key properties of methyl 5-(furan-2-yl)-1,3-thiazole-4-carboxylate?
methyl 5-(furan-2-yl)-1,3-thiazole-4-carboxylate has a molecular weight of 209.23 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(furan-2-yl)-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 53271132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).