C11H8ClNO2S — CID 53271192
5-(3-chlorophenyl)-2-methyl-1,3-thiazole-4-carboxylic acid (PubChem CID 53271192) has the molecular formula C11H8ClNO2S and a molecular weight of 253.71 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-2-methyl-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-(3-chlorophenyl)-2-methyl-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 53271192 |
| Molecular Formula | C11H8ClNO2S |
| Molecular Weight | 253.71 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | 5-(3-chlorophenyl)-2-methyl-1,3-thiazole-4-carboxylic acid |
| SMILES | Cc1nc(C(=O)O)c(-c2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C11H8ClNO2S/c1-6-13-9(11(14)15)10(16-6)7-3-2-4-8(12)5-7/h2-5H,1H3,(H,14,15) |
| InChIKey | UKTAGVSEPAZCCQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.71 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |