C17H14BrN6+ — CID 5327131
5-(3-bromophenyl)-N-(pyridin-4-ylmethyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-8-ium-7-amine (PubChem CID 5327131) has the molecular formula C17H14BrN6+ and a molecular weight of 382.25 g/mol. Its IUPAC name is 5-(3-bromophenyl)-N-(pyridin-4-ylmethyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-8-ium-7-amine.
| Compound Name | 5-(3-bromophenyl)-N-(pyridin-4-ylmethyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-8-ium-7-amine |
|---|---|
| PubChem CID | 5327131 |
| Molecular Formula | C17H14BrN6+ |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 5-(3-bromophenyl)-N-(pyridin-4-ylmethyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-8-ium-7-amine |
| SMILES | Brc1cccc(-c2cc(NCc3ccncc3)[n+]3[nH]cnc3n2)c1 |
| InChI | InChI=1S/C17H13BrN6/c18-14-3-1-2-13(8-14)15-9-16(24-17(23-15)21-11-22-24)20-10-12-4-6-19-7-5-12/h1-9,11H,10H2,(H,20,21,22,23)/p+1 |
| InChIKey | YWBFPKPWMSWWEA-UHFFFAOYSA-O |
| XLogP | 2.98 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|