About N-[(5-phenyl-1,3-thiazol-2-yl)methyl]piperidin-1-amine
N-[(5-phenyl-1,3-thiazol-2-yl)methyl]piperidin-1-amine (PubChem CID 53271584) has the molecular formula C15H19N3S
and a molecular weight of 273.40 g/mol. Its IUPAC name is N-[(5-phenyl-1,3-thiazol-2-yl)methyl]piperidin-1-amine.
Molecular Properties
| Compound Name | N-[(5-phenyl-1,3-thiazol-2-yl)methyl]piperidin-1-amine |
| PubChem CID | 53271584 |
| Molecular Formula | C15H19N3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | N-[(5-phenyl-1,3-thiazol-2-yl)methyl]piperidin-1-amine |
| SMILES | c1ccc(-c2cnc(CNN3CCCCC3)s2)cc1 |
| InChI | InChI=1S/C15H19N3S/c1-3-7-13(8-4-1)14-11-16-15(19-14)12-17-18-9-5-2-6-10-18/h1,3-4,7-8,11,17H,2,5-6,9-10,12H2 |
| InChIKey | WBLXBIKCCXYVSW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(5-phenyl-1,3-thiazol-2-yl)methyl]piperidin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-phenyl-1,3-thiazol-2-yl)methyl]piperidin-1-amine?
The IUPAC name of N-[(5-phenyl-1,3-thiazol-2-yl)methyl]piperidin-1-amine (CID 53271584) is N-[(5-phenyl-1,3-thiazol-2-yl)methyl]piperidin-1-amine.
What is the SMILES notation for N-[(5-phenyl-1,3-thiazol-2-yl)methyl]piperidin-1-amine?
The canonical SMILES for N-[(5-phenyl-1,3-thiazol-2-yl)methyl]piperidin-1-amine is c1ccc(-c2cnc(CNN3CCCCC3)s2)cc1.
What is the InChIKey of N-[(5-phenyl-1,3-thiazol-2-yl)methyl]piperidin-1-amine?
The InChIKey is WBLXBIKCCXYVSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3S/c1-3-7-13(8-4-1)14-11-16-15(19-14)12-17-18-9-5-2-6-10-18/h1,3-4,7-8,11,17H,2,5-6,9-10,12H2.
What are the key properties of N-[(5-phenyl-1,3-thiazol-2-yl)methyl]piperidin-1-amine?
N-[(5-phenyl-1,3-thiazol-2-yl)methyl]piperidin-1-amine has a molecular weight of 273.40 g/mol, XLogP of 3.30, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-phenyl-1,3-thiazol-2-yl)methyl]piperidin-1-amine is sourced from PubChem (CID 53271584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).