C19H21N3O2S — CID 53271885
N-[[5-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]methyl]-2-pyridin-2-ylethanamine (PubChem CID 53271885) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is N-[[5-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]methyl]-2-pyridin-2-ylethanamine.
| Compound Name | N-[[5-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]methyl]-2-pyridin-2-ylethanamine |
|---|---|
| PubChem CID | 53271885 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-[[5-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]methyl]-2-pyridin-2-ylethanamine |
| SMILES | COc1ccc(OC)c(-c2cnc(CNCCc3ccccn3)s2)c1 |
| InChI | InChI=1S/C19H21N3O2S/c1-23-15-6-7-17(24-2)16(11-15)18-12-22-19(25-18)13-20-10-8-14-5-3-4-9-21-14/h3-7,9,11-12,20H,8,10,13H2,1-2H3 |
| InChIKey | RXUHBHBATUWUNI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|