C45H50F6N4O5 — CID 5327202
N-[5-[(4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-2-oxo-3-[5-[[3-(trifluoromethyl)benzoyl]amino]pentyl]-1,3-diazepan-1-yl]pentyl]-3-(trifluoromethyl)benzamide (PubChem CID 5327202) has the molecular formula C45H50F6N4O5 and a molecular weight of 840.91 g/mol. Its IUPAC name is N-[5-[(4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-2-oxo-3-[5-[[3-(trifluoromethyl)benzoyl]amino]pentyl]-1,3-diazepan-1-yl]pentyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[5-[(4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-2-oxo-3-[5-[[3-(trifluoromethyl)benzoyl]amino]pentyl]-1,3-diazepan-1-yl]pentyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 5327202 |
| Molecular Formula | C45H50F6N4O5 |
| Molecular Weight | 840.91 g/mol |
| Exact Mass | 840.37 |
| IUPAC Name | N-[5-[(4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-2-oxo-3-[5-[[3-(trifluoromethyl)benzoyl]amino]pentyl]-1,3-diazepan-1-yl]pentyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCCCCN1C(=O)N(CCCCCNC(=O)c2cccc(C(F)(F)F)c2)[C@H](Cc2ccccc2)[C@H](O)[C@@H](O)[C@H]1Cc1ccccc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C45H50F6N4O5/c46-44(47,48)35-21-13-19-33(29-35)41(58)52-23-9-3-11-25-54-37(27-31-15-5-1-6-16-31)39(56)40(57)38(28-32-17-7-2-8-18-32)55(43(54)60)26-12-4-10-24-53-42(59)34-20-14-22-36(30-34)45(49,50)51/h1-2,5-8,13-22,29-30,37-40,56-57H,3-4,9-12,23-28H2,(H,52,58)(H,53,59)/t37-,38-,39+,40+/m1/s1 |
| InChIKey | VDZJTPNTOORHAL-WESAGZJESA-N |
| XLogP | 7.91 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.91 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|