C31H46N2O5 — CID 5327226
(4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-1,3-bis(5-hydroxyhexyl)-1,3-diazepan-2-one (PubChem CID 5327226) has the molecular formula C31H46N2O5 and a molecular weight of 526.72 g/mol. Its IUPAC name is (4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-1,3-bis(5-hydroxyhexyl)-1,3-diazepan-2-one.
| Compound Name | (4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-1,3-bis(5-hydroxyhexyl)-1,3-diazepan-2-one |
|---|---|
| PubChem CID | 5327226 |
| Molecular Formula | C31H46N2O5 |
| Molecular Weight | 526.72 g/mol |
| Exact Mass | 526.34 |
| IUPAC Name | (4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-1,3-bis(5-hydroxyhexyl)-1,3-diazepan-2-one |
| SMILES | CC(O)CCCCN1C(=O)N(CCCCC(C)O)[C@H](Cc2ccccc2)[C@H](O)[C@@H](O)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C31H46N2O5/c1-23(34)13-9-11-19-32-27(21-25-15-5-3-6-16-25)29(36)30(37)28(22-26-17-7-4-8-18-26)33(31(32)38)20-12-10-14-24(2)35/h3-8,15-18,23-24,27-30,34-37H,9-14,19-22H2,1-2H3/t23?,24?,27-,28-,29+,30+/m1/s1 |
| InChIKey | AKQNCFFQZVSLCC-RNKQMKKOSA-N |
| XLogP | 3.77 |
| TPSA | 104.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.72 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|