About 2-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1,1-dimethylhydrazine
2-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1,1-dimethylhydrazine (PubChem CID 53272272) has the molecular formula C12H14FN3S
and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1,1-dimethylhydrazine.
Molecular Properties
| Compound Name | 2-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1,1-dimethylhydrazine |
| PubChem CID | 53272272 |
| Molecular Formula | C12H14FN3S |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 2-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1,1-dimethylhydrazine |
| SMILES | CN(C)NCc1ncc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C12H14FN3S/c1-16(2)15-8-12-14-7-11(17-12)9-3-5-10(13)6-4-9/h3-7,15H,8H2,1-2H3 |
| InChIKey | NQNLZSSDUZRKBZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1,1-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1,1-dimethylhydrazine?
The IUPAC name of 2-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1,1-dimethylhydrazine (CID 53272272) is 2-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1,1-dimethylhydrazine.
What is the SMILES notation for 2-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1,1-dimethylhydrazine?
The canonical SMILES for 2-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1,1-dimethylhydrazine is CN(C)NCc1ncc(-c2ccc(F)cc2)s1.
What is the InChIKey of 2-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1,1-dimethylhydrazine?
The InChIKey is NQNLZSSDUZRKBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FN3S/c1-16(2)15-8-12-14-7-11(17-12)9-3-5-10(13)6-4-9/h3-7,15H,8H2,1-2H3.
What are the key properties of 2-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1,1-dimethylhydrazine?
2-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1,1-dimethylhydrazine has a molecular weight of 251.33 g/mol, XLogP of 2.52, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1,1-dimethylhydrazine is sourced from PubChem (CID 53272272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).