About N-[[5-(2-fluorophenyl)-1,3-thiazol-2-yl]methyl]morpholin-4-amine
N-[[5-(2-fluorophenyl)-1,3-thiazol-2-yl]methyl]morpholin-4-amine (PubChem CID 53272281) has the molecular formula C14H16FN3OS
and a molecular weight of 293.37 g/mol. Its IUPAC name is N-[[5-(2-fluorophenyl)-1,3-thiazol-2-yl]methyl]morpholin-4-amine.
Molecular Properties
| Compound Name | N-[[5-(2-fluorophenyl)-1,3-thiazol-2-yl]methyl]morpholin-4-amine |
| PubChem CID | 53272281 |
| Molecular Formula | C14H16FN3OS |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N-[[5-(2-fluorophenyl)-1,3-thiazol-2-yl]methyl]morpholin-4-amine |
| SMILES | Fc1ccccc1-c1cnc(CNN2CCOCC2)s1 |
| InChI | InChI=1S/C14H16FN3OS/c15-12-4-2-1-3-11(12)13-9-16-14(20-13)10-17-18-5-7-19-8-6-18/h1-4,9,17H,5-8,10H2 |
| InChIKey | UCFJIFJODQKVNA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[5-(2-fluorophenyl)-1,3-thiazol-2-yl]methyl]morpholin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-(2-fluorophenyl)-1,3-thiazol-2-yl]methyl]morpholin-4-amine?
The IUPAC name of N-[[5-(2-fluorophenyl)-1,3-thiazol-2-yl]methyl]morpholin-4-amine (CID 53272281) is N-[[5-(2-fluorophenyl)-1,3-thiazol-2-yl]methyl]morpholin-4-amine.
What is the SMILES notation for N-[[5-(2-fluorophenyl)-1,3-thiazol-2-yl]methyl]morpholin-4-amine?
The canonical SMILES for N-[[5-(2-fluorophenyl)-1,3-thiazol-2-yl]methyl]morpholin-4-amine is Fc1ccccc1-c1cnc(CNN2CCOCC2)s1.
What is the InChIKey of N-[[5-(2-fluorophenyl)-1,3-thiazol-2-yl]methyl]morpholin-4-amine?
The InChIKey is UCFJIFJODQKVNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16FN3OS/c15-12-4-2-1-3-11(12)13-9-16-14(20-13)10-17-18-5-7-19-8-6-18/h1-4,9,17H,5-8,10H2.
What are the key properties of N-[[5-(2-fluorophenyl)-1,3-thiazol-2-yl]methyl]morpholin-4-amine?
N-[[5-(2-fluorophenyl)-1,3-thiazol-2-yl]methyl]morpholin-4-amine has a molecular weight of 293.37 g/mol, XLogP of 2.29, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-(2-fluorophenyl)-1,3-thiazol-2-yl]methyl]morpholin-4-amine is sourced from PubChem (CID 53272281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).