C30H44N2O6S — CID 5327229
(4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-1-(5-hydroxypentyl)-3-(5-methylsulfonylpentyl)-1,3-diazepan-2-one (PubChem CID 5327229) has the molecular formula C30H44N2O6S and a molecular weight of 560.76 g/mol. Its IUPAC name is (4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-1-(5-hydroxypentyl)-3-(5-methylsulfonylpentyl)-1,3-diazepan-2-one.
| Compound Name | (4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-1-(5-hydroxypentyl)-3-(5-methylsulfonylpentyl)-1,3-diazepan-2-one |
|---|---|
| PubChem CID | 5327229 |
| Molecular Formula | C30H44N2O6S |
| Molecular Weight | 560.76 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | (4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-1-(5-hydroxypentyl)-3-(5-methylsulfonylpentyl)-1,3-diazepan-2-one |
| SMILES | CS(=O)(=O)CCCCCN1C(=O)N(CCCCCO)[C@H](Cc2ccccc2)[C@H](O)[C@@H](O)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C30H44N2O6S/c1-39(37,38)21-13-5-11-19-32-27(23-25-16-8-3-9-17-25)29(35)28(34)26(22-24-14-6-2-7-15-24)31(30(32)36)18-10-4-12-20-33/h2-3,6-9,14-17,26-29,33-35H,4-5,10-13,18-23H2,1H3/t26-,27-,28+,29+/m1/s1 |
| InChIKey | WOSXSJHAZUAABD-GKQHHHCTSA-N |
| XLogP | 3.05 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.76 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|