About N-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1-[4-(trifluoromethyl)phenyl]methanamine
N-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1-[4-(trifluoromethyl)phenyl]methanamine (PubChem CID 53272304) has the molecular formula C18H14F4N2S
and a molecular weight of 366.38 g/mol. Its IUPAC name is N-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1-[4-(trifluoromethyl)phenyl]methanamine.
Molecular Properties
| Compound Name | N-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1-[4-(trifluoromethyl)phenyl]methanamine |
| PubChem CID | 53272304 |
| Molecular Formula | C18H14F4N2S |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | N-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1-[4-(trifluoromethyl)phenyl]methanamine |
| SMILES | Fc1ccc(-c2cnc(CNCc3ccc(C(F)(F)F)cc3)s2)cc1 |
| InChI | InChI=1S/C18H14F4N2S/c19-15-7-3-13(4-8-15)16-10-24-17(25-16)11-23-9-12-1-5-14(6-2-12)18(20,21)22/h1-8,10,23H,9,11H2 |
| InChIKey | KJPFDSSHUIOUJP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1-[4-(trifluoromethyl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1-[4-(trifluoromethyl)phenyl]methanamine?
The IUPAC name of N-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1-[4-(trifluoromethyl)phenyl]methanamine (CID 53272304) is N-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1-[4-(trifluoromethyl)phenyl]methanamine.
What is the SMILES notation for N-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1-[4-(trifluoromethyl)phenyl]methanamine?
The canonical SMILES for N-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1-[4-(trifluoromethyl)phenyl]methanamine is Fc1ccc(-c2cnc(CNCc3ccc(C(F)(F)F)cc3)s2)cc1.
What is the InChIKey of N-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1-[4-(trifluoromethyl)phenyl]methanamine?
The InChIKey is KJPFDSSHUIOUJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14F4N2S/c19-15-7-3-13(4-8-15)16-10-24-17(25-16)11-23-9-12-1-5-14(6-2-12)18(20,21)22/h1-8,10,23H,9,11H2.
What are the key properties of N-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1-[4-(trifluoromethyl)phenyl]methanamine?
N-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1-[4-(trifluoromethyl)phenyl]methanamine has a molecular weight of 366.38 g/mol, XLogP of 5.26, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-1-[4-(trifluoromethyl)phenyl]methanamine is sourced from PubChem (CID 53272304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).