C33H48N4O7 — CID 5327237
methyl N-[5-[(4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-3-[5-(methoxycarbonylamino)pentyl]-2-oxo-1,3-diazepan-1-yl]pentyl]carbamate (PubChem CID 5327237) has the molecular formula C33H48N4O7 and a molecular weight of 612.77 g/mol. Its IUPAC name is methyl N-[5-[(4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-3-[5-(methoxycarbonylamino)pentyl]-2-oxo-1,3-diazepan-1-yl]pentyl]carbamate.
| Compound Name | methyl N-[5-[(4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-3-[5-(methoxycarbonylamino)pentyl]-2-oxo-1,3-diazepan-1-yl]pentyl]carbamate |
|---|---|
| PubChem CID | 5327237 |
| Molecular Formula | C33H48N4O7 |
| Molecular Weight | 612.77 g/mol |
| Exact Mass | 612.35 |
| IUPAC Name | methyl N-[5-[(4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-3-[5-(methoxycarbonylamino)pentyl]-2-oxo-1,3-diazepan-1-yl]pentyl]carbamate |
| SMILES | COC(=O)NCCCCCN1C(=O)N(CCCCCNC(=O)OC)[C@H](Cc2ccccc2)[C@H](O)[C@@H](O)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C33H48N4O7/c1-43-31(40)34-19-11-5-13-21-36-27(23-25-15-7-3-8-16-25)29(38)30(39)28(24-26-17-9-4-10-18-26)37(33(36)42)22-14-6-12-20-35-32(41)44-2/h3-4,7-10,15-18,27-30,38-39H,5-6,11-14,19-24H2,1-2H3,(H,34,40)(H,35,41)/t27-,28-,29+,30+/m1/s1 |
| InChIKey | YGCQZFGUBAXOFA-XAZDILKDSA-N |
| XLogP | 3.72 |
| TPSA | 140.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.77 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|