C29H36N4O3 — CID 5327250
5-[(4R,5S,6S,7R)-4,7-dibenzyl-3-(4-cyanobutyl)-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]pentanenitrile (PubChem CID 5327250) has the molecular formula C29H36N4O3 and a molecular weight of 488.63 g/mol. Its IUPAC name is 5-[(4R,5S,6S,7R)-4,7-dibenzyl-3-(4-cyanobutyl)-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]pentanenitrile.
| Compound Name | 5-[(4R,5S,6S,7R)-4,7-dibenzyl-3-(4-cyanobutyl)-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]pentanenitrile |
|---|---|
| PubChem CID | 5327250 |
| Molecular Formula | C29H36N4O3 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | 5-[(4R,5S,6S,7R)-4,7-dibenzyl-3-(4-cyanobutyl)-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]pentanenitrile |
| SMILES | N#CCCCCN1C(=O)N(CCCCC#N)[C@H](Cc2ccccc2)[C@H](O)[C@@H](O)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C29H36N4O3/c30-17-9-3-11-19-32-25(21-23-13-5-1-6-14-23)27(34)28(35)26(22-24-15-7-2-8-16-24)33(29(32)36)20-12-4-10-18-31/h1-2,5-8,13-16,25-28,34-35H,3-4,9-12,19-22H2/t25-,26-,27+,28+/m1/s1 |
| InChIKey | YHBNJXDOWCKLMO-VIJSPRBVSA-N |
| XLogP | 4.06 |
| TPSA | 111.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|