C39H58N2O5 — CID 5327279
(4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-1,3-bis[2-[3-(2-hydroxypropyl)-2,2-dimethylcyclopropyl]ethyl]-1,3-diazepan-2-one (PubChem CID 5327279) has the molecular formula C39H58N2O5 and a molecular weight of 634.90 g/mol. Its IUPAC name is (4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-1,3-bis[2-[3-(2-hydroxypropyl)-2,2-dimethylcyclopropyl]ethyl]-1,3-diazepan-2-one.
| Compound Name | (4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-1,3-bis[2-[3-(2-hydroxypropyl)-2,2-dimethylcyclopropyl]ethyl]-1,3-diazepan-2-one |
|---|---|
| PubChem CID | 5327279 |
| Molecular Formula | C39H58N2O5 |
| Molecular Weight | 634.90 g/mol |
| Exact Mass | 634.43 |
| IUPAC Name | (4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-1,3-bis[2-[3-(2-hydroxypropyl)-2,2-dimethylcyclopropyl]ethyl]-1,3-diazepan-2-one |
| SMILES | CC(O)CC1C(CCN2C(=O)N(CCC3C(CC(C)O)C3(C)C)[C@H](Cc3ccccc3)[C@H](O)[C@@H](O)[C@H]2Cc2ccccc2)C1(C)C |
| InChI | InChI=1S/C39H58N2O5/c1-25(42)21-31-29(38(31,3)4)17-19-40-33(23-27-13-9-7-10-14-27)35(44)36(45)34(24-28-15-11-8-12-16-28)41(37(40)46)20-18-30-32(22-26(2)43)39(30,5)6/h7-16,25-26,29-36,42-45H,17-24H2,1-6H3/t25?,26?,29?,30?,31?,32?,33-,34-,35+,36+/m1/s1 |
| InChIKey | JNHYHLHMBTYIMN-IQVGKYBMSA-N |
| XLogP | 5.53 |
| TPSA | 104.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.90 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |