C33H48N4O3 — CID 5327284
(4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-1,3-bis(2-piperidin-4-ylethyl)-1,3-diazepan-2-one (PubChem CID 5327284) has the molecular formula C33H48N4O3 and a molecular weight of 548.77 g/mol. Its IUPAC name is (4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-1,3-bis(2-piperidin-4-ylethyl)-1,3-diazepan-2-one.
| Compound Name | (4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-1,3-bis(2-piperidin-4-ylethyl)-1,3-diazepan-2-one |
|---|---|
| PubChem CID | 5327284 |
| Molecular Formula | C33H48N4O3 |
| Molecular Weight | 548.77 g/mol |
| Exact Mass | 548.37 |
| IUPAC Name | (4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-1,3-bis(2-piperidin-4-ylethyl)-1,3-diazepan-2-one |
| SMILES | O=C1N(CCC2CCNCC2)[C@H](Cc2ccccc2)[C@H](O)[C@@H](O)[C@@H](Cc2ccccc2)N1CCC1CCNCC1 |
| InChI | InChI=1S/C33H48N4O3/c38-31-29(23-27-7-3-1-4-8-27)36(21-15-25-11-17-34-18-12-25)33(40)37(22-16-26-13-19-35-20-14-26)30(32(31)39)24-28-9-5-2-6-10-28/h1-10,25-26,29-32,34-35,38-39H,11-24H2/t29-,30-,31+,32+/m1/s1 |
| InChIKey | QCFLNAJMYWWHRE-ZRTHHSRSSA-N |
| XLogP | 3.45 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.77 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |