About 4-propanoylmorpholine-2,6-dione
4-propanoylmorpholine-2,6-dione (PubChem CID 53273571) has the molecular formula C7H9NO4
and a molecular weight of 171.15 g/mol. Its IUPAC name is 4-propanoylmorpholine-2,6-dione.
Molecular Properties
| Compound Name | 4-propanoylmorpholine-2,6-dione |
| PubChem CID | 53273571 |
| Molecular Formula | C7H9NO4 |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 4-propanoylmorpholine-2,6-dione |
| SMILES | CCC(=O)N1CC(=O)OC(=O)C1 |
| InChI | InChI=1S/C7H9NO4/c1-2-5(9)8-3-6(10)12-7(11)4-8/h2-4H2,1H3 |
| InChIKey | NRYYGKWDAYVKIX-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-propanoylmorpholine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propanoylmorpholine-2,6-dione?
The IUPAC name of 4-propanoylmorpholine-2,6-dione (CID 53273571) is 4-propanoylmorpholine-2,6-dione.
What is the SMILES notation for 4-propanoylmorpholine-2,6-dione?
The canonical SMILES for 4-propanoylmorpholine-2,6-dione is CCC(=O)N1CC(=O)OC(=O)C1.
What is the InChIKey of 4-propanoylmorpholine-2,6-dione?
The InChIKey is NRYYGKWDAYVKIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO4/c1-2-5(9)8-3-6(10)12-7(11)4-8/h2-4H2,1H3.
What are the key properties of 4-propanoylmorpholine-2,6-dione?
4-propanoylmorpholine-2,6-dione has a molecular weight of 171.15 g/mol, XLogP of -0.69, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propanoylmorpholine-2,6-dione is sourced from PubChem (CID 53273571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).