C36H36N2O6S2 — CID 5327381
(3S,4R)-2-benzyl-1,1-dioxo-3,6-bis(phenoxymethyl)-7-[(3-thiophen-2-ylphenyl)methyl]-1,2,7-thiadiazepane-4,5-diol (PubChem CID 5327381) has the molecular formula C36H36N2O6S2 and a molecular weight of 656.83 g/mol. Its IUPAC name is (3S,4R)-2-benzyl-1,1-dioxo-3,6-bis(phenoxymethyl)-7-[(3-thiophen-2-ylphenyl)methyl]-1,2,7-thiadiazepane-4,5-diol.
| Compound Name | (3S,4R)-2-benzyl-1,1-dioxo-3,6-bis(phenoxymethyl)-7-[(3-thiophen-2-ylphenyl)methyl]-1,2,7-thiadiazepane-4,5-diol |
|---|---|
| PubChem CID | 5327381 |
| Molecular Formula | C36H36N2O6S2 |
| Molecular Weight | 656.83 g/mol |
| Exact Mass | 656.20 |
| IUPAC Name | (3S,4R)-2-benzyl-1,1-dioxo-3,6-bis(phenoxymethyl)-7-[(3-thiophen-2-ylphenyl)methyl]-1,2,7-thiadiazepane-4,5-diol |
| SMILES | O=S1(=O)N(Cc2cccc(-c3cccs3)c2)C(COc2ccccc2)C(O)[C@H](O)[C@H](COc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C36H36N2O6S2/c39-35-32(25-43-30-16-6-2-7-17-30)37(23-27-12-4-1-5-13-27)46(41,42)38(33(36(35)40)26-44-31-18-8-3-9-19-31)24-28-14-10-15-29(22-28)34-20-11-21-45-34/h1-22,32-33,35-36,39-40H,23-26H2/t32-,33?,35+,36?/m0/s1 |
| InChIKey | BZHUTTKEDGUJII-JXLBTLCCSA-N |
| XLogP | 5.59 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.83 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |