About N-[3-[(2,4-dichlorophenyl)methyl]-4-(methylaminomethyl)oxadiazol-3-ium-5-yl]acetamide
N-[3-[(2,4-dichlorophenyl)methyl]-4-(methylaminomethyl)oxadiazol-3-ium-5-yl]acetamide (PubChem CID 53274726) has the molecular formula C13H15Cl2N4O2+
and a molecular weight of 330.20 g/mol. Its IUPAC name is N-[3-[(2,4-dichlorophenyl)methyl]-4-(methylaminomethyl)oxadiazol-3-ium-5-yl]acetamide.
Molecular Properties
| Compound Name | N-[3-[(2,4-dichlorophenyl)methyl]-4-(methylaminomethyl)oxadiazol-3-ium-5-yl]acetamide |
| PubChem CID | 53274726 |
| Molecular Formula | C13H15Cl2N4O2+ |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | N-[3-[(2,4-dichlorophenyl)methyl]-4-(methylaminomethyl)oxadiazol-3-ium-5-yl]acetamide |
| SMILES | CNCc1c(NC(C)=O)on[n+]1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H14Cl2N4O2/c1-8(20)17-13-12(6-16-2)19(18-21-13)7-9-3-4-10(14)5-11(9)15/h3-5,16H,6-7H2,1-2H3/p+1 |
| InChIKey | DRBZYYFGCWJOOJ-UHFFFAOYSA-O |
| XLogP | 2.00 |
| TPSA | 71.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[(2,4-dichlorophenyl)methyl]-4-(methylaminomethyl)oxadiazol-3-ium-5-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(2,4-dichlorophenyl)methyl]-4-(methylaminomethyl)oxadiazol-3-ium-5-yl]acetamide?
The IUPAC name of N-[3-[(2,4-dichlorophenyl)methyl]-4-(methylaminomethyl)oxadiazol-3-ium-5-yl]acetamide (CID 53274726) is N-[3-[(2,4-dichlorophenyl)methyl]-4-(methylaminomethyl)oxadiazol-3-ium-5-yl]acetamide.
What is the SMILES notation for N-[3-[(2,4-dichlorophenyl)methyl]-4-(methylaminomethyl)oxadiazol-3-ium-5-yl]acetamide?
The canonical SMILES for N-[3-[(2,4-dichlorophenyl)methyl]-4-(methylaminomethyl)oxadiazol-3-ium-5-yl]acetamide is CNCc1c(NC(C)=O)on[n+]1Cc1ccc(Cl)cc1Cl.
What is the InChIKey of N-[3-[(2,4-dichlorophenyl)methyl]-4-(methylaminomethyl)oxadiazol-3-ium-5-yl]acetamide?
The InChIKey is DRBZYYFGCWJOOJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H14Cl2N4O2/c1-8(20)17-13-12(6-16-2)19(18-21-13)7-9-3-4-10(14)5-11(9)15/h3-5,16H,6-7H2,1-2H3/p+1.
What are the key properties of N-[3-[(2,4-dichlorophenyl)methyl]-4-(methylaminomethyl)oxadiazol-3-ium-5-yl]acetamide?
N-[3-[(2,4-dichlorophenyl)methyl]-4-(methylaminomethyl)oxadiazol-3-ium-5-yl]acetamide has a molecular weight of 330.20 g/mol, XLogP of 2.00, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(2,4-dichlorophenyl)methyl]-4-(methylaminomethyl)oxadiazol-3-ium-5-yl]acetamide is sourced from PubChem (CID 53274726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).