About 5-sulfanylidene-3,4-dihydro-2H-thieno[3,2-b]pyridine-6-carbonitrile
5-sulfanylidene-3,4-dihydro-2H-thieno[3,2-b]pyridine-6-carbonitrile (PubChem CID 53275043) has the molecular formula C8H6N2S2
and a molecular weight of 194.28 g/mol. Its IUPAC name is 5-sulfanylidene-3,4-dihydro-2H-thieno[3,2-b]pyridine-6-carbonitrile.
Molecular Properties
| Compound Name | 5-sulfanylidene-3,4-dihydro-2H-thieno[3,2-b]pyridine-6-carbonitrile |
| PubChem CID | 53275043 |
| Molecular Formula | C8H6N2S2 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.00 |
| IUPAC Name | 5-sulfanylidene-3,4-dihydro-2H-thieno[3,2-b]pyridine-6-carbonitrile |
| SMILES | N#Cc1cc2c([nH]c1=S)CCS2 |
| InChI | InChI=1S/C8H6N2S2/c9-4-5-3-7-6(1-2-12-7)10-8(5)11/h3H,1-2H2,(H,10,11) |
| InChIKey | DDJUGKLERXXEMY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyano_pyridone_A(54)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-sulfanylidene-3,4-dihydro-2H-thieno[3,2-b]pyridine-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-sulfanylidene-3,4-dihydro-2H-thieno[3,2-b]pyridine-6-carbonitrile?
The IUPAC name of 5-sulfanylidene-3,4-dihydro-2H-thieno[3,2-b]pyridine-6-carbonitrile (CID 53275043) is 5-sulfanylidene-3,4-dihydro-2H-thieno[3,2-b]pyridine-6-carbonitrile.
What is the SMILES notation for 5-sulfanylidene-3,4-dihydro-2H-thieno[3,2-b]pyridine-6-carbonitrile?
The canonical SMILES for 5-sulfanylidene-3,4-dihydro-2H-thieno[3,2-b]pyridine-6-carbonitrile is N#Cc1cc2c([nH]c1=S)CCS2.
What is the InChIKey of 5-sulfanylidene-3,4-dihydro-2H-thieno[3,2-b]pyridine-6-carbonitrile?
The InChIKey is DDJUGKLERXXEMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2S2/c9-4-5-3-7-6(1-2-12-7)10-8(5)11/h3H,1-2H2,(H,10,11).
What are the key properties of 5-sulfanylidene-3,4-dihydro-2H-thieno[3,2-b]pyridine-6-carbonitrile?
5-sulfanylidene-3,4-dihydro-2H-thieno[3,2-b]pyridine-6-carbonitrile has a molecular weight of 194.28 g/mol, XLogP of 2.26, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-sulfanylidene-3,4-dihydro-2H-thieno[3,2-b]pyridine-6-carbonitrile is sourced from PubChem (CID 53275043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).